C19H25N3O3S2 — CID 9193466
3-[(4-benzylpiperidin-1-yl)methyl]-5-[(3S)-1,1-dioxothiolan-3-yl]-1,3,4-oxadiazole-2-thione (PubChem CID 9193466) has the molecular formula C19H25N3O3S2 and a molecular weight of 407.56 g/mol. Its IUPAC name is 3-[(4-benzylpiperidin-1-yl)methyl]-5-[(3S)-1,1-dioxothiolan-3-yl]-1,3,4-oxadiazole-2-thione.
| Compound Name | 3-[(4-benzylpiperidin-1-yl)methyl]-5-[(3S)-1,1-dioxothiolan-3-yl]-1,3,4-oxadiazole-2-thione |
|---|---|
| PubChem CID | 9193466 |
| Molecular Formula | C19H25N3O3S2 |
| Molecular Weight | 407.56 g/mol |
| Exact Mass | 407.13 |
| IUPAC Name | 3-[(4-benzylpiperidin-1-yl)methyl]-5-[(3S)-1,1-dioxothiolan-3-yl]-1,3,4-oxadiazole-2-thione |
| SMILES | O=S1(=O)CC[C@@H](c2nn(CN3CCC(Cc4ccccc4)CC3)c(=S)o2)C1 |
| InChI | InChI=1S/C19H25N3O3S2/c23-27(24)11-8-17(13-27)18-20-22(19(26)25-18)14-21-9-6-16(7-10-21)12-15-4-2-1-3-5-15/h1-5,16-17H,6-14H2/t17-/m1/s1 |
| InChIKey | NRPJVVWYIYPFGE-QGZVFWFLSA-N |
| XLogP | 3.02 |
| TPSA | 68.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.56 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|