C16H21N3O3S2 — CID 9231963
3-[[benzyl(ethyl)amino]methyl]-5-[(3R)-1,1-dioxothiolan-3-yl]-1,3,4-oxadiazole-2-thione (PubChem CID 9231963) has the molecular formula C16H21N3O3S2 and a molecular weight of 367.50 g/mol. Its IUPAC name is 3-[[benzyl(ethyl)amino]methyl]-5-[(3R)-1,1-dioxothiolan-3-yl]-1,3,4-oxadiazole-2-thione.
| Compound Name | 3-[[benzyl(ethyl)amino]methyl]-5-[(3R)-1,1-dioxothiolan-3-yl]-1,3,4-oxadiazole-2-thione |
|---|---|
| PubChem CID | 9231963 |
| Molecular Formula | C16H21N3O3S2 |
| Molecular Weight | 367.50 g/mol |
| Exact Mass | 367.10 |
| IUPAC Name | 3-[[benzyl(ethyl)amino]methyl]-5-[(3R)-1,1-dioxothiolan-3-yl]-1,3,4-oxadiazole-2-thione |
| SMILES | CCN(Cc1ccccc1)Cn1nc([C@H]2CCS(=O)(=O)C2)oc1=S |
| InChI | InChI=1S/C16H21N3O3S2/c1-2-18(10-13-6-4-3-5-7-13)12-19-16(23)22-15(17-19)14-8-9-24(20,21)11-14/h3-7,14H,2,8-12H2,1H3/t14-/m0/s1 |
| InChIKey | QUNIFIHLMBEARY-AWEZNQCLSA-N |
| XLogP | 2.59 |
| TPSA | 68.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.50 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|