C17H23N3O3S2 — CID 9193898
3-[[benzyl(ethyl)amino]methyl]-5-[[(3S)-1,1-dioxothiolan-3-yl]methyl]-1,3,4-oxadiazole-2-thione (PubChem CID 9193898) has the molecular formula C17H23N3O3S2 and a molecular weight of 381.52 g/mol. Its IUPAC name is 3-[[benzyl(ethyl)amino]methyl]-5-[[(3S)-1,1-dioxothiolan-3-yl]methyl]-1,3,4-oxadiazole-2-thione.
| Compound Name | 3-[[benzyl(ethyl)amino]methyl]-5-[[(3S)-1,1-dioxothiolan-3-yl]methyl]-1,3,4-oxadiazole-2-thione |
|---|---|
| PubChem CID | 9193898 |
| Molecular Formula | C17H23N3O3S2 |
| Molecular Weight | 381.52 g/mol |
| Exact Mass | 381.12 |
| IUPAC Name | 3-[[benzyl(ethyl)amino]methyl]-5-[[(3S)-1,1-dioxothiolan-3-yl]methyl]-1,3,4-oxadiazole-2-thione |
| SMILES | CCN(Cc1ccccc1)Cn1nc(C[C@H]2CCS(=O)(=O)C2)oc1=S |
| InChI | InChI=1S/C17H23N3O3S2/c1-2-19(11-14-6-4-3-5-7-14)13-20-17(24)23-16(18-20)10-15-8-9-25(21,22)12-15/h3-7,15H,2,8-13H2,1H3/t15-/m1/s1 |
| InChIKey | YVLWZUWQGIVRGQ-OAHLLOKOSA-N |
| XLogP | 2.66 |
| TPSA | 68.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.52 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|