C12H17N7S2 — CID 9232275
5-(methylamino)-3-[(4-pyrimidin-2-ylpiperazin-1-yl)methyl]-1,3,4-thiadiazole-2-thione (PubChem CID 9232275) has the molecular formula C12H17N7S2 and a molecular weight of 323.45 g/mol. Its IUPAC name is 5-(methylamino)-3-[(4-pyrimidin-2-ylpiperazin-1-yl)methyl]-1,3,4-thiadiazole-2-thione.
| Compound Name | 5-(methylamino)-3-[(4-pyrimidin-2-ylpiperazin-1-yl)methyl]-1,3,4-thiadiazole-2-thione |
|---|---|
| PubChem CID | 9232275 |
| Molecular Formula | C12H17N7S2 |
| Molecular Weight | 323.45 g/mol |
| Exact Mass | 323.10 |
| IUPAC Name | 5-(methylamino)-3-[(4-pyrimidin-2-ylpiperazin-1-yl)methyl]-1,3,4-thiadiazole-2-thione |
| SMILES | CNc1nn(CN2CCN(c3ncccn3)CC2)c(=S)s1 |
| InChI | InChI=1S/C12H17N7S2/c1-13-11-16-19(12(20)21-11)9-17-5-7-18(8-6-17)10-14-3-2-4-15-10/h2-4H,5-9H2,1H3,(H,13,16) |
| InChIKey | CSXCAXPIYMSVCW-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 62.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.45 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|