C13H16N4S2 — CID 9183916
3-(3,4-dihydro-1H-isoquinolin-2-ylmethyl)-5-(methylamino)-1,3,4-thiadiazole-2-thione (PubChem CID 9183916) has the molecular formula C13H16N4S2 and a molecular weight of 292.43 g/mol. Its IUPAC name is 3-(3,4-dihydro-1H-isoquinolin-2-ylmethyl)-5-(methylamino)-1,3,4-thiadiazole-2-thione.
| Compound Name | 3-(3,4-dihydro-1H-isoquinolin-2-ylmethyl)-5-(methylamino)-1,3,4-thiadiazole-2-thione |
|---|---|
| PubChem CID | 9183916 |
| Molecular Formula | C13H16N4S2 |
| Molecular Weight | 292.43 g/mol |
| Exact Mass | 292.08 |
| IUPAC Name | 3-(3,4-dihydro-1H-isoquinolin-2-ylmethyl)-5-(methylamino)-1,3,4-thiadiazole-2-thione |
| SMILES | CNc1nn(CN2CCc3ccccc3C2)c(=S)s1 |
| InChI | InChI=1S/C13H16N4S2/c1-14-12-15-17(13(18)19-12)9-16-7-6-10-4-2-3-5-11(10)8-16/h2-5H,6-9H2,1H3,(H,14,15) |
| InChIKey | IKTNBWMZWZCAHK-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.43 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|