C18H20ClN4OS+ — CID 9332541
(5-chloro-2-methoxyphenyl)methyl-methyl-[(5-phenyl-3-sulfanylidene-1H-1,2,4-triazol-2-yl)methyl]azanium (PubChem CID 9332541) has the molecular formula C18H20ClN4OS+ and a molecular weight of 375.91 g/mol. Its IUPAC name is (5-chloro-2-methoxyphenyl)methyl-methyl-[(5-phenyl-3-sulfanylidene-1H-1,2,4-triazol-2-yl)methyl]azanium.
| Compound Name | (5-chloro-2-methoxyphenyl)methyl-methyl-[(5-phenyl-3-sulfanylidene-1H-1,2,4-triazol-2-yl)methyl]azanium |
|---|---|
| PubChem CID | 9332541 |
| Molecular Formula | C18H20ClN4OS+ |
| Molecular Weight | 375.91 g/mol |
| Exact Mass | 375.10 |
| IUPAC Name | (5-chloro-2-methoxyphenyl)methyl-methyl-[(5-phenyl-3-sulfanylidene-1H-1,2,4-triazol-2-yl)methyl]azanium |
| SMILES | COc1ccc(Cl)cc1C[NH+](C)Cn1[nH]c(-c2ccccc2)nc1=S |
| InChI | InChI=1S/C18H19ClN4OS/c1-22(11-14-10-15(19)8-9-16(14)24-2)12-23-18(25)20-17(21-23)13-6-4-3-5-7-13/h3-10H,11-12H2,1-2H3,(H,20,21,25)/p+1 |
| InChIKey | JRDDVWGRAQXYRP-UHFFFAOYSA-O |
| XLogP | 2.94 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.91 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|