C10H13N5O2 — CID 79506309
1-[(3,4-dimethoxyphenyl)methyl]tetrazol-5-amine (PubChem CID 79506309) has the molecular formula C10H13N5O2 and a molecular weight of 235.25 g/mol. Its IUPAC name is 1-[(3,4-dimethoxyphenyl)methyl]tetrazol-5-amine.
| Compound Name | 1-[(3,4-dimethoxyphenyl)methyl]tetrazol-5-amine |
|---|---|
| PubChem CID | 79506309 |
| Molecular Formula | C10H13N5O2 |
| Molecular Weight | 235.25 g/mol |
| Exact Mass | 235.11 |
| IUPAC Name | 1-[(3,4-dimethoxyphenyl)methyl]tetrazol-5-amine |
| SMILES | COc1ccc(Cn2nnnc2N)cc1OC |
| InChI | InChI=1S/C10H13N5O2/c1-16-8-4-3-7(5-9(8)17-2)6-15-10(11)12-13-14-15/h3-5H,6H2,1-2H3,(H2,11,12,14) |
| InChIKey | AJCNYTDEYKMDEM-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 88.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.25 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |