C13H16N4O3 — CID 107345092
4-amino-1-[(3,4-dimethoxyphenyl)methyl]pyrazole-3-carboxamide (PubChem CID 107345092) has the molecular formula C13H16N4O3 and a molecular weight of 276.30 g/mol. Its IUPAC name is 4-amino-1-[(3,4-dimethoxyphenyl)methyl]pyrazole-3-carboxamide.
| Compound Name | 4-amino-1-[(3,4-dimethoxyphenyl)methyl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 107345092 |
| Molecular Formula | C13H16N4O3 |
| Molecular Weight | 276.30 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | 4-amino-1-[(3,4-dimethoxyphenyl)methyl]pyrazole-3-carboxamide |
| SMILES | COc1ccc(Cn2cc(N)c(C(N)=O)n2)cc1OC |
| InChI | InChI=1S/C13H16N4O3/c1-19-10-4-3-8(5-11(10)20-2)6-17-7-9(14)12(16-17)13(15)18/h3-5,7H,6,14H2,1-2H3,(H2,15,18) |
| InChIKey | GHEDSDYCYUBLPE-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 105.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.30 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |