1-[(3,4-dimethoxyphenyl)methyl]pyrrole-3-carboxylic acid

C14H15NO4 — CID 79103442

IUPAC1-[(3,4-dimethoxyphenyl)methyl]pyrrole-3-carboxylic acid
SMILESCOc1ccc(Cn2ccc(C(=O)O)c2)cc1OC
InChIInChI=1S/C14H15NO4/c1-18-12-4-3-10(7-13(12)19-2)8-15-6-5-11(9-15)14(16)17/h3-7,9H,8H2,1-2H3,(H,16,17)
InChIKeyNAKDATPFCVIALW-UHFFFAOYSA-N
MW261.28 g/mol
LogP2.25
Rot. Bonds5

About 1-[(3,4-dimethoxyphenyl)methyl]pyrrole-3-carboxylic acid

1-[(3,4-dimethoxyphenyl)methyl]pyrrole-3-carboxylic acid (PubChem CID 79103442) has the molecular formula C14H15NO4 and a molecular weight of 261.28 g/mol. Its IUPAC name is 1-[(3,4-dimethoxyphenyl)methyl]pyrrole-3-carboxylic acid.

Molecular Properties

Compound Name1-[(3,4-dimethoxyphenyl)methyl]pyrrole-3-carboxylic acid
PubChem CID79103442
Molecular FormulaC14H15NO4
Molecular Weight261.28 g/mol
Exact Mass261.10
IUPAC Name1-[(3,4-dimethoxyphenyl)methyl]pyrrole-3-carboxylic acid
SMILESCOc1ccc(Cn2ccc(C(=O)O)c2)cc1OC
InChIInChI=1S/C14H15NO4/c1-18-12-4-3-10(7-13(12)19-2)8-15-6-5-11(9-15)14(16)17/h3-7,9H,8H2,1-2H3,(H,16,17)
InChIKeyNAKDATPFCVIALW-UHFFFAOYSA-N
XLogP2.25
TPSA60.69 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500261.28
LogP ≤ 52.25
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 1-[(3,4-dimethoxyphenyl)methyl]pyrrole-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-[(3,4-dimethoxyphenyl)methyl]pyrrole-3-carboxylic acid?
The IUPAC name of 1-[(3,4-dimethoxyphenyl)methyl]pyrrole-3-carboxylic acid (CID 79103442) is 1-[(3,4-dimethoxyphenyl)methyl]pyrrole-3-carboxylic acid.
What is the SMILES notation for 1-[(3,4-dimethoxyphenyl)methyl]pyrrole-3-carboxylic acid?
The canonical SMILES for 1-[(3,4-dimethoxyphenyl)methyl]pyrrole-3-carboxylic acid is COc1ccc(Cn2ccc(C(=O)O)c2)cc1OC.
What is the InChIKey of 1-[(3,4-dimethoxyphenyl)methyl]pyrrole-3-carboxylic acid?
The InChIKey is NAKDATPFCVIALW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15NO4/c1-18-12-4-3-10(7-13(12)19-2)8-15-6-5-11(9-15)14(16)17/h3-7,9H,8H2,1-2H3,(H,16,17).
What are the key properties of 1-[(3,4-dimethoxyphenyl)methyl]pyrrole-3-carboxylic acid?
1-[(3,4-dimethoxyphenyl)methyl]pyrrole-3-carboxylic acid has a molecular weight of 261.28 g/mol, XLogP of 2.25, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3,4-dimethoxyphenyl)methyl]pyrrole-3-carboxylic acid is sourced from PubChem (CID 79103442), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).