C14H15NO3 — CID 13147290
1-[(3,4-dimethoxyphenyl)methyl]pyrrole-3-carbaldehyde (PubChem CID 13147290) has the molecular formula C14H15NO3 and a molecular weight of 245.28 g/mol. Its IUPAC name is 1-[(3,4-dimethoxyphenyl)methyl]pyrrole-3-carbaldehyde.
| Compound Name | 1-[(3,4-dimethoxyphenyl)methyl]pyrrole-3-carbaldehyde |
|---|---|
| PubChem CID | 13147290 |
| Molecular Formula | C14H15NO3 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.11 |
| IUPAC Name | 1-[(3,4-dimethoxyphenyl)methyl]pyrrole-3-carbaldehyde |
| SMILES | COc1ccc(Cn2ccc(C=O)c2)cc1OC |
| InChI | InChI=1S/C14H15NO3/c1-17-13-4-3-11(7-14(13)18-2)8-15-6-5-12(9-15)10-16/h3-7,9-10H,8H2,1-2H3 |
| InChIKey | PJIDUTLPZVTZNK-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 40.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|