C13H13BrN2O3 — CID 13494111
5-bromo-3-[(3,4-dimethoxyphenyl)methyl]imidazole-4-carbaldehyde (PubChem CID 13494111) has the molecular formula C13H13BrN2O3 and a molecular weight of 325.16 g/mol. Its IUPAC name is 5-bromo-3-[(3,4-dimethoxyphenyl)methyl]imidazole-4-carbaldehyde.
| Compound Name | 5-bromo-3-[(3,4-dimethoxyphenyl)methyl]imidazole-4-carbaldehyde |
|---|---|
| PubChem CID | 13494111 |
| Molecular Formula | C13H13BrN2O3 |
| Molecular Weight | 325.16 g/mol |
| Exact Mass | 324.01 |
| IUPAC Name | 5-bromo-3-[(3,4-dimethoxyphenyl)methyl]imidazole-4-carbaldehyde |
| SMILES | COc1ccc(Cn2cnc(Br)c2C=O)cc1OC |
| InChI | InChI=1S/C13H13BrN2O3/c1-18-11-4-3-9(5-12(11)19-2)6-16-8-15-13(14)10(16)7-17/h3-5,7-8H,6H2,1-2H3 |
| InChIKey | LUFUOVXNPUEBIX-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.16 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|