C13H12Cl2N2O3 — CID 114583279
5,6-dichloro-3-[(3,4-dimethoxyphenyl)methyl]pyrimidin-4-one (PubChem CID 114583279) has the molecular formula C13H12Cl2N2O3 and a molecular weight of 315.16 g/mol. Its IUPAC name is 5,6-dichloro-3-[(3,4-dimethoxyphenyl)methyl]pyrimidin-4-one.
| Compound Name | 5,6-dichloro-3-[(3,4-dimethoxyphenyl)methyl]pyrimidin-4-one |
|---|---|
| PubChem CID | 114583279 |
| Molecular Formula | C13H12Cl2N2O3 |
| Molecular Weight | 315.16 g/mol |
| Exact Mass | 314.02 |
| IUPAC Name | 5,6-dichloro-3-[(3,4-dimethoxyphenyl)methyl]pyrimidin-4-one |
| SMILES | COc1ccc(Cn2cnc(Cl)c(Cl)c2=O)cc1OC |
| InChI | InChI=1S/C13H12Cl2N2O3/c1-19-9-4-3-8(5-10(9)20-2)6-17-7-16-12(15)11(14)13(17)18/h3-5,7H,6H2,1-2H3 |
| InChIKey | CVZVZZSDRNQWBJ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.16 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |