C22H17ClN6O3 — CID 66496776
5-(4-chlorophenyl)-11-[(3,4-dimethoxyphenyl)methyl]-2,3,7,8,11,13-hexazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-10-one (PubChem CID 66496776) has the molecular formula C22H17ClN6O3 and a molecular weight of 448.87 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-11-[(3,4-dimethoxyphenyl)methyl]-2,3,7,8,11,13-hexazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-10-one.
| Compound Name | 5-(4-chlorophenyl)-11-[(3,4-dimethoxyphenyl)methyl]-2,3,7,8,11,13-hexazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-10-one |
|---|---|
| PubChem CID | 66496776 |
| Molecular Formula | C22H17ClN6O3 |
| Molecular Weight | 448.87 g/mol |
| Exact Mass | 448.11 |
| IUPAC Name | 5-(4-chlorophenyl)-11-[(3,4-dimethoxyphenyl)methyl]-2,3,7,8,11,13-hexazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-10-one |
| SMILES | COc1ccc(Cn2cnc3c(nnc4c(-c5ccc(Cl)cc5)cnn43)c2=O)cc1OC |
| InChI | InChI=1S/C22H17ClN6O3/c1-31-17-8-3-13(9-18(17)32-2)11-28-12-24-21-19(22(28)30)26-27-20-16(10-25-29(20)21)14-4-6-15(23)7-5-14/h3-10,12H,11H2,1-2H3 |
| InChIKey | LSBNIYZZBHPQBP-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 96.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.87 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |