C16H11ClN6O3S — CID 66496841
2-[5-(4-chlorophenyl)-10-oxo-2,3,7,8,11,13-hexazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-11-yl]-3-sulfanylpropanoic acid (PubChem CID 66496841) has the molecular formula C16H11ClN6O3S and a molecular weight of 402.82 g/mol. Its IUPAC name is 2-[5-(4-chlorophenyl)-10-oxo-2,3,7,8,11,13-hexazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-11-yl]-3-sulfanylpropanoic acid.
| Compound Name | 2-[5-(4-chlorophenyl)-10-oxo-2,3,7,8,11,13-hexazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-11-yl]-3-sulfanylpropanoic acid |
|---|---|
| PubChem CID | 66496841 |
| Molecular Formula | C16H11ClN6O3S |
| Molecular Weight | 402.82 g/mol |
| Exact Mass | 402.03 |
| IUPAC Name | 2-[5-(4-chlorophenyl)-10-oxo-2,3,7,8,11,13-hexazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-11-yl]-3-sulfanylpropanoic acid |
| SMILES | O=C(O)C(CS)n1cnc2c(nnc3c(-c4ccc(Cl)cc4)cnn32)c1=O |
| InChI | InChI=1S/C16H11ClN6O3S/c17-9-3-1-8(2-4-9)10-5-19-23-13(10)21-20-12-14(23)18-7-22(15(12)24)11(6-27)16(25)26/h1-5,7,11,27H,6H2,(H,25,26) |
| InChIKey | OUGLBFZGCBGOQQ-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 115.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.82 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|