C19H12ClN7O — CID 66496873
5-(4-chlorophenyl)-11-(pyridin-2-ylmethyl)-2,3,7,8,11,13-hexazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-10-one (PubChem CID 66496873) has the molecular formula C19H12ClN7O and a molecular weight of 389.81 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-11-(pyridin-2-ylmethyl)-2,3,7,8,11,13-hexazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-10-one.
| Compound Name | 5-(4-chlorophenyl)-11-(pyridin-2-ylmethyl)-2,3,7,8,11,13-hexazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-10-one |
|---|---|
| PubChem CID | 66496873 |
| Molecular Formula | C19H12ClN7O |
| Molecular Weight | 389.81 g/mol |
| Exact Mass | 389.08 |
| IUPAC Name | 5-(4-chlorophenyl)-11-(pyridin-2-ylmethyl)-2,3,7,8,11,13-hexazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-10-one |
| SMILES | O=c1c2nnc3c(-c4ccc(Cl)cc4)cnn3c2ncn1Cc1ccccn1 |
| InChI | InChI=1S/C19H12ClN7O/c20-13-6-4-12(5-7-13)15-9-23-27-17(15)25-24-16-18(27)22-11-26(19(16)28)10-14-3-1-2-8-21-14/h1-9,11H,10H2 |
| InChIKey | RWFKAZTVYHALFX-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 90.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.81 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |