C14H9ClN6O — CID 66496637
11-[(4-chlorophenyl)methyl]-2,3,7,8,11,13-hexazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-10-one (PubChem CID 66496637) has the molecular formula C14H9ClN6O and a molecular weight of 312.72 g/mol. Its IUPAC name is 11-[(4-chlorophenyl)methyl]-2,3,7,8,11,13-hexazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-10-one.
| Compound Name | 11-[(4-chlorophenyl)methyl]-2,3,7,8,11,13-hexazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-10-one |
|---|---|
| PubChem CID | 66496637 |
| Molecular Formula | C14H9ClN6O |
| Molecular Weight | 312.72 g/mol |
| Exact Mass | 312.05 |
| IUPAC Name | 11-[(4-chlorophenyl)methyl]-2,3,7,8,11,13-hexazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-10-one |
| SMILES | O=c1c2nnc3ccnn3c2ncn1Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H9ClN6O/c15-10-3-1-9(2-4-10)7-20-8-16-13-12(14(20)22)19-18-11-5-6-17-21(11)13/h1-6,8H,7H2 |
| InChIKey | YAHGMKHIVSTZCV-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 77.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.72 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |