C17H14N6O3 — CID 66496622
4-(10-oxo-5-phenyl-2,3,7,8,11,13-hexazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-11-yl)butanoic acid (PubChem CID 66496622) has the molecular formula C17H14N6O3 and a molecular weight of 350.34 g/mol. Its IUPAC name is 4-(10-oxo-5-phenyl-2,3,7,8,11,13-hexazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-11-yl)butanoic acid.
| Compound Name | 4-(10-oxo-5-phenyl-2,3,7,8,11,13-hexazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-11-yl)butanoic acid |
|---|---|
| PubChem CID | 66496622 |
| Molecular Formula | C17H14N6O3 |
| Molecular Weight | 350.34 g/mol |
| Exact Mass | 350.11 |
| IUPAC Name | 4-(10-oxo-5-phenyl-2,3,7,8,11,13-hexazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-11-yl)butanoic acid |
| SMILES | O=C(O)CCCn1cnc2c(nnc3c(-c4ccccc4)cnn32)c1=O |
| InChI | InChI=1S/C17H14N6O3/c24-13(25)7-4-8-22-10-18-16-14(17(22)26)20-21-15-12(9-19-23(15)16)11-5-2-1-3-6-11/h1-3,5-6,9-10H,4,7-8H2,(H,24,25) |
| InChIKey | CJLHZMVAXPRSLW-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 115.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.34 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |