C18H16N6O3S — CID 66496679
2-(4-ethyl-10-oxo-5-phenyl-2,3,7,8,11,13-hexazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-11-yl)-3-sulfanylpropanoic acid (PubChem CID 66496679) has the molecular formula C18H16N6O3S and a molecular weight of 396.43 g/mol. Its IUPAC name is 2-(4-ethyl-10-oxo-5-phenyl-2,3,7,8,11,13-hexazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-11-yl)-3-sulfanylpropanoic acid.
| Compound Name | 2-(4-ethyl-10-oxo-5-phenyl-2,3,7,8,11,13-hexazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-11-yl)-3-sulfanylpropanoic acid |
|---|---|
| PubChem CID | 66496679 |
| Molecular Formula | C18H16N6O3S |
| Molecular Weight | 396.43 g/mol |
| Exact Mass | 396.10 |
| IUPAC Name | 2-(4-ethyl-10-oxo-5-phenyl-2,3,7,8,11,13-hexazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-11-yl)-3-sulfanylpropanoic acid |
| SMILES | CCc1nn2c(nnc3c(=O)n(C(CS)C(=O)O)cnc32)c1-c1ccccc1 |
| InChI | InChI=1S/C18H16N6O3S/c1-2-11-13(10-6-4-3-5-7-10)15-21-20-14-16(24(15)22-11)19-9-23(17(14)25)12(8-28)18(26)27/h3-7,9,12,28H,2,8H2,1H3,(H,26,27) |
| InChIKey | IEAUOGGASMXJRJ-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 115.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.43 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|