C22H17ClN6O2 — CID 66496505
11-[(2-chlorophenyl)methyl]-4-(methoxymethyl)-5-phenyl-2,3,7,8,11,13-hexazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-10-one (PubChem CID 66496505) has the molecular formula C22H17ClN6O2 and a molecular weight of 432.87 g/mol. Its IUPAC name is 11-[(2-chlorophenyl)methyl]-4-(methoxymethyl)-5-phenyl-2,3,7,8,11,13-hexazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-10-one.
| Compound Name | 11-[(2-chlorophenyl)methyl]-4-(methoxymethyl)-5-phenyl-2,3,7,8,11,13-hexazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-10-one |
|---|---|
| PubChem CID | 66496505 |
| Molecular Formula | C22H17ClN6O2 |
| Molecular Weight | 432.87 g/mol |
| Exact Mass | 432.11 |
| IUPAC Name | 11-[(2-chlorophenyl)methyl]-4-(methoxymethyl)-5-phenyl-2,3,7,8,11,13-hexazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-10-one |
| SMILES | COCc1nn2c(nnc3c(=O)n(Cc4ccccc4Cl)cnc32)c1-c1ccccc1 |
| InChI | InChI=1S/C22H17ClN6O2/c1-31-12-17-18(14-7-3-2-4-8-14)20-26-25-19-21(29(20)27-17)24-13-28(22(19)30)11-15-9-5-6-10-16(15)23/h2-10,13H,11-12H2,1H3 |
| InChIKey | ZTHWPCQRRMKXMG-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 87.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.87 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |