C21H17N7O — CID 66496595
4-ethyl-5-phenyl-11-(pyridin-3-ylmethyl)-2,3,7,8,11,13-hexazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-10-one (PubChem CID 66496595) has the molecular formula C21H17N7O and a molecular weight of 383.42 g/mol. Its IUPAC name is 4-ethyl-5-phenyl-11-(pyridin-3-ylmethyl)-2,3,7,8,11,13-hexazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-10-one.
| Compound Name | 4-ethyl-5-phenyl-11-(pyridin-3-ylmethyl)-2,3,7,8,11,13-hexazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-10-one |
|---|---|
| PubChem CID | 66496595 |
| Molecular Formula | C21H17N7O |
| Molecular Weight | 383.42 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | 4-ethyl-5-phenyl-11-(pyridin-3-ylmethyl)-2,3,7,8,11,13-hexazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-10-one |
| SMILES | CCc1nn2c(nnc3c(=O)n(Cc4cccnc4)cnc32)c1-c1ccccc1 |
| InChI | InChI=1S/C21H17N7O/c1-2-16-17(15-8-4-3-5-9-15)19-25-24-18-20(28(19)26-16)23-13-27(21(18)29)12-14-7-6-10-22-11-14/h3-11,13H,2,12H2,1H3 |
| InChIKey | IISRSXCSWGWWAS-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 90.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.42 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |