C18H15FN6O3 — CID 66496994
3-[4-ethyl-5-(4-fluorophenyl)-10-oxo-2,3,7,8,11,13-hexazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-11-yl]propanoic acid (PubChem CID 66496994) has the molecular formula C18H15FN6O3 and a molecular weight of 382.36 g/mol. Its IUPAC name is 3-[4-ethyl-5-(4-fluorophenyl)-10-oxo-2,3,7,8,11,13-hexazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-11-yl]propanoic acid.
| Compound Name | 3-[4-ethyl-5-(4-fluorophenyl)-10-oxo-2,3,7,8,11,13-hexazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-11-yl]propanoic acid |
|---|---|
| PubChem CID | 66496994 |
| Molecular Formula | C18H15FN6O3 |
| Molecular Weight | 382.36 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | 3-[4-ethyl-5-(4-fluorophenyl)-10-oxo-2,3,7,8,11,13-hexazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-11-yl]propanoic acid |
| SMILES | CCc1nn2c(nnc3c(=O)n(CCC(=O)O)cnc32)c1-c1ccc(F)cc1 |
| InChI | InChI=1S/C18H15FN6O3/c1-2-12-14(10-3-5-11(19)6-4-10)16-22-21-15-17(25(16)23-12)20-9-24(18(15)28)8-7-13(26)27/h3-6,9H,2,7-8H2,1H3,(H,26,27) |
| InChIKey | WYEPTYWUSOQMAX-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 115.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.36 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |