C20H21FN6O — CID 66496993
4-ethyl-5-(4-fluorophenyl)-11-pentyl-2,3,7,8,11,13-hexazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-10-one (PubChem CID 66496993) has the molecular formula C20H21FN6O and a molecular weight of 380.43 g/mol. Its IUPAC name is 4-ethyl-5-(4-fluorophenyl)-11-pentyl-2,3,7,8,11,13-hexazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-10-one.
| Compound Name | 4-ethyl-5-(4-fluorophenyl)-11-pentyl-2,3,7,8,11,13-hexazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-10-one |
|---|---|
| PubChem CID | 66496993 |
| Molecular Formula | C20H21FN6O |
| Molecular Weight | 380.43 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | 4-ethyl-5-(4-fluorophenyl)-11-pentyl-2,3,7,8,11,13-hexazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-10-one |
| SMILES | CCCCCn1cnc2c(nnc3c(-c4ccc(F)cc4)c(CC)nn32)c1=O |
| InChI | InChI=1S/C20H21FN6O/c1-3-5-6-11-26-12-22-19-17(20(26)28)23-24-18-16(15(4-2)25-27(18)19)13-7-9-14(21)10-8-13/h7-10,12H,3-6,11H2,1-2H3 |
| InChIKey | VUGMVXOQUXFAMD-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 77.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.43 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|