C20H17ClN8O2 — CID 66497088
5-(4-chlorophenyl)-11-[2-(1H-imidazol-5-yl)ethyl]-4-(methoxymethyl)-2,3,7,8,11,13-hexazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-10-one (PubChem CID 66497088) has the molecular formula C20H17ClN8O2 and a molecular weight of 436.86 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-11-[2-(1H-imidazol-5-yl)ethyl]-4-(methoxymethyl)-2,3,7,8,11,13-hexazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-10-one.
| Compound Name | 5-(4-chlorophenyl)-11-[2-(1H-imidazol-5-yl)ethyl]-4-(methoxymethyl)-2,3,7,8,11,13-hexazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-10-one |
|---|---|
| PubChem CID | 66497088 |
| Molecular Formula | C20H17ClN8O2 |
| Molecular Weight | 436.86 g/mol |
| Exact Mass | 436.12 |
| IUPAC Name | 5-(4-chlorophenyl)-11-[2-(1H-imidazol-5-yl)ethyl]-4-(methoxymethyl)-2,3,7,8,11,13-hexazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-10-one |
| SMILES | COCc1nn2c(nnc3c(=O)n(CCc4cnc[nH]4)cnc32)c1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H17ClN8O2/c1-31-9-15-16(12-2-4-13(21)5-3-12)18-26-25-17-19(29(18)27-15)24-11-28(20(17)30)7-6-14-8-22-10-23-14/h2-5,8,10-11H,6-7,9H2,1H3,(H,22,23) |
| InChIKey | FGSYIDPFXNRZAE-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 115.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.86 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |