C19H17N5 — CID 118986602
7-ethyl-4,8-diphenylpyrazolo[5,1-c][1,2,4]triazin-3-amine (PubChem CID 118986602) has the molecular formula C19H17N5 and a molecular weight of 315.38 g/mol. Its IUPAC name is 7-ethyl-4,8-diphenylpyrazolo[5,1-c][1,2,4]triazin-3-amine.
| Compound Name | 7-ethyl-4,8-diphenylpyrazolo[5,1-c][1,2,4]triazin-3-amine |
|---|---|
| PubChem CID | 118986602 |
| Molecular Formula | C19H17N5 |
| Molecular Weight | 315.38 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | 7-ethyl-4,8-diphenylpyrazolo[5,1-c][1,2,4]triazin-3-amine |
| SMILES | CCc1nn2c(-c3ccccc3)c(N)nnc2c1-c1ccccc1 |
| InChI | InChI=1S/C19H17N5/c1-2-15-16(13-9-5-3-6-10-13)19-22-21-18(20)17(24(19)23-15)14-11-7-4-8-12-14/h3-12H,2,20H2,1H3 |
| InChIKey | JSUDRZKLSAHIBY-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 69.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.38 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |