About 4-methyl-6-phenyl-2H-pyrazolo[3,4-d]pyrimidin-3-amine
4-methyl-6-phenyl-2H-pyrazolo[3,4-d]pyrimidin-3-amine (PubChem CID 821854) has the molecular formula C12H11N5
and a molecular weight of 225.25 g/mol. Its IUPAC name is 4-methyl-6-phenyl-2H-pyrazolo[3,4-d]pyrimidin-3-amine.
Molecular Properties
| Compound Name | 4-methyl-6-phenyl-2H-pyrazolo[3,4-d]pyrimidin-3-amine |
| PubChem CID | 821854 |
| Molecular Formula | C12H11N5 |
| Molecular Weight | 225.25 g/mol |
| Exact Mass | 225.10 |
| IUPAC Name | 4-methyl-6-phenyl-2H-pyrazolo[3,4-d]pyrimidin-3-amine |
| SMILES | Cc1nc(-c2ccccc2)nc2n[nH]c(N)c12 |
| InChI | InChI=1S/C12H11N5/c1-7-9-10(13)16-17-12(9)15-11(14-7)8-5-3-2-4-6-8/h2-6H,1H3,(H3,13,14,15,16,17) |
| InChIKey | MNASYFFAXISTPQ-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.25 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-methyl-6-phenyl-2H-pyrazolo[3,4-d]pyrimidin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-6-phenyl-2H-pyrazolo[3,4-d]pyrimidin-3-amine?
The IUPAC name of 4-methyl-6-phenyl-2H-pyrazolo[3,4-d]pyrimidin-3-amine (CID 821854) is 4-methyl-6-phenyl-2H-pyrazolo[3,4-d]pyrimidin-3-amine.
What is the SMILES notation for 4-methyl-6-phenyl-2H-pyrazolo[3,4-d]pyrimidin-3-amine?
The canonical SMILES for 4-methyl-6-phenyl-2H-pyrazolo[3,4-d]pyrimidin-3-amine is Cc1nc(-c2ccccc2)nc2n[nH]c(N)c12.
What is the InChIKey of 4-methyl-6-phenyl-2H-pyrazolo[3,4-d]pyrimidin-3-amine?
The InChIKey is MNASYFFAXISTPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11N5/c1-7-9-10(13)16-17-12(9)15-11(14-7)8-5-3-2-4-6-8/h2-6H,1H3,(H3,13,14,15,16,17).
What are the key properties of 4-methyl-6-phenyl-2H-pyrazolo[3,4-d]pyrimidin-3-amine?
4-methyl-6-phenyl-2H-pyrazolo[3,4-d]pyrimidin-3-amine has a molecular weight of 225.25 g/mol, XLogP of 1.91, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-6-phenyl-2H-pyrazolo[3,4-d]pyrimidin-3-amine is sourced from PubChem (CID 821854), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).