C7H8N4 — CID 768687
6-methyl-2H-pyrazolo[3,4-b]pyridin-3-amine (PubChem CID 768687) has the molecular formula C7H8N4 and a molecular weight of 148.17 g/mol. Its IUPAC name is 6-methyl-2H-pyrazolo[3,4-b]pyridin-3-amine.
| Compound Name | 6-methyl-2H-pyrazolo[3,4-b]pyridin-3-amine |
|---|---|
| PubChem CID | 768687 |
| Molecular Formula | C7H8N4 |
| Molecular Weight | 148.17 g/mol |
| Exact Mass | 148.07 |
| IUPAC Name | 6-methyl-2H-pyrazolo[3,4-b]pyridin-3-amine |
| SMILES | Cc1ccc2c(N)[nH]nc2n1 |
| InChI | InChI=1S/C7H8N4/c1-4-2-3-5-6(8)10-11-7(5)9-4/h2-3H,1H3,(H3,8,9,10,11) |
| InChIKey | ICQJGRLWSLEFFW-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.17 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |