C10H9FN6 — CID 6401723
(8-fluoro-5-methyl-[1,2,4]triazino[5,6-b]indol-3-yl)hydrazine (PubChem CID 6401723) has the molecular formula C10H9FN6 and a molecular weight of 232.22 g/mol. Its IUPAC name is (8-fluoro-5-methyl-[1,2,4]triazino[5,6-b]indol-3-yl)hydrazine.
| Compound Name | (8-fluoro-5-methyl-[1,2,4]triazino[5,6-b]indol-3-yl)hydrazine |
|---|---|
| PubChem CID | 6401723 |
| Molecular Formula | C10H9FN6 |
| Molecular Weight | 232.22 g/mol |
| Exact Mass | 232.09 |
| IUPAC Name | (8-fluoro-5-methyl-[1,2,4]triazino[5,6-b]indol-3-yl)hydrazine |
| SMILES | Cn1c2ccc(F)cc2c2nnc(NN)nc21 |
| InChI | InChI=1S/C10H9FN6/c1-17-7-3-2-5(11)4-6(7)8-9(17)13-10(14-12)16-15-8/h2-4H,12H2,1H3,(H,13,14,16) |
| InChIKey | IBGRXEZCLXJMCC-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.22 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|