C15H14N6 — CID 25263282
N,1-dimethyl-7-phenylpyrazolo[5,1-b]purin-4-amine (PubChem CID 25263282) has the molecular formula C15H14N6 and a molecular weight of 278.32 g/mol. Its IUPAC name is N,1-dimethyl-7-phenylpyrazolo[5,1-b]purin-4-amine.
| Compound Name | N,1-dimethyl-7-phenylpyrazolo[5,1-b]purin-4-amine |
|---|---|
| PubChem CID | 25263282 |
| Molecular Formula | C15H14N6 |
| Molecular Weight | 278.32 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | N,1-dimethyl-7-phenylpyrazolo[5,1-b]purin-4-amine |
| SMILES | CNc1nc2cc(-c3ccccc3)nn2c2c1ncn2C |
| InChI | InChI=1S/C15H14N6/c1-16-14-13-15(20(2)9-17-13)21-12(18-14)8-11(19-21)10-6-4-3-5-7-10/h3-9H,1-2H3,(H,16,18) |
| InChIKey | SKZBDNWUNUGWAT-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 60.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.32 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |