C13H15ClN2O2 — CID 66151662
5-(chloromethyl)-1-[(3,4-dimethoxyphenyl)methyl]imidazole (PubChem CID 66151662) has the molecular formula C13H15ClN2O2 and a molecular weight of 266.73 g/mol. Its IUPAC name is 5-(chloromethyl)-1-[(3,4-dimethoxyphenyl)methyl]imidazole.
| Compound Name | 5-(chloromethyl)-1-[(3,4-dimethoxyphenyl)methyl]imidazole |
|---|---|
| PubChem CID | 66151662 |
| Molecular Formula | C13H15ClN2O2 |
| Molecular Weight | 266.73 g/mol |
| Exact Mass | 266.08 |
| IUPAC Name | 5-(chloromethyl)-1-[(3,4-dimethoxyphenyl)methyl]imidazole |
| SMILES | COc1ccc(Cn2cncc2CCl)cc1OC |
| InChI | InChI=1S/C13H15ClN2O2/c1-17-12-4-3-10(5-13(12)18-2)8-16-9-15-7-11(16)6-14/h3-5,7,9H,6,8H2,1-2H3 |
| InChIKey | ZHHSXBRPLIFIEA-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.73 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|