C12H12Cl2N2O2 — CID 18670780
1-(1,3-benzodioxol-5-ylmethyl)-5-(chloromethyl)imidazole;hydrochloride (PubChem CID 18670780) has the molecular formula C12H12Cl2N2O2 and a molecular weight of 287.15 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-ylmethyl)-5-(chloromethyl)imidazole;hydrochloride.
| Compound Name | 1-(1,3-benzodioxol-5-ylmethyl)-5-(chloromethyl)imidazole;hydrochloride |
|---|---|
| PubChem CID | 18670780 |
| Molecular Formula | C12H12Cl2N2O2 |
| Molecular Weight | 287.15 g/mol |
| Exact Mass | 286.03 |
| IUPAC Name | 1-(1,3-benzodioxol-5-ylmethyl)-5-(chloromethyl)imidazole;hydrochloride |
| SMILES | Cl.ClCc1cncn1Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C12H11ClN2O2.ClH/c13-4-10-5-14-7-15(10)6-9-1-2-11-12(3-9)17-8-16-11;/h1-3,5,7H,4,6,8H2;1H |
| InChIKey | SVTFIURFUUNRIS-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.15 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|