C28H24F4N4O2S — CID 174452876
1-[3-[3-(1,3-benzodioxol-5-ylmethyl)imidazol-4-yl]-1-[2-(trifluoromethyl)phenyl]propyl]-1-(4-fluorophenyl)thiourea (PubChem CID 174452876) has the molecular formula C28H24F4N4O2S and a molecular weight of 556.59 g/mol. Its IUPAC name is 1-[3-[3-(1,3-benzodioxol-5-ylmethyl)imidazol-4-yl]-1-[2-(trifluoromethyl)phenyl]propyl]-1-(4-fluorophenyl)thiourea.
| Compound Name | 1-[3-[3-(1,3-benzodioxol-5-ylmethyl)imidazol-4-yl]-1-[2-(trifluoromethyl)phenyl]propyl]-1-(4-fluorophenyl)thiourea |
|---|---|
| PubChem CID | 174452876 |
| Molecular Formula | C28H24F4N4O2S |
| Molecular Weight | 556.59 g/mol |
| Exact Mass | 556.16 |
| IUPAC Name | 1-[3-[3-(1,3-benzodioxol-5-ylmethyl)imidazol-4-yl]-1-[2-(trifluoromethyl)phenyl]propyl]-1-(4-fluorophenyl)thiourea |
| SMILES | NC(=S)N(c1ccc(F)cc1)C(CCc1cncn1Cc1ccc2c(c1)OCO2)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C28H24F4N4O2S/c29-19-6-8-20(9-7-19)36(27(33)39)24(22-3-1-2-4-23(22)28(30,31)32)11-10-21-14-34-16-35(21)15-18-5-12-25-26(13-18)38-17-37-25/h1-9,12-14,16,24H,10-11,15,17H2,(H2,33,39) |
| InChIKey | LSRFCGKFADDWQP-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.59 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|