C25H26F3N5S — CID 139942691
1-[2-[3-[(4-cyanophenyl)methyl]imidazol-4-yl]ethyl]-3-propyl-1-[[2-(trifluoromethyl)phenyl]methyl]thiourea (PubChem CID 139942691) has the molecular formula C25H26F3N5S and a molecular weight of 485.58 g/mol. Its IUPAC name is 1-[2-[3-[(4-cyanophenyl)methyl]imidazol-4-yl]ethyl]-3-propyl-1-[[2-(trifluoromethyl)phenyl]methyl]thiourea.
| Compound Name | 1-[2-[3-[(4-cyanophenyl)methyl]imidazol-4-yl]ethyl]-3-propyl-1-[[2-(trifluoromethyl)phenyl]methyl]thiourea |
|---|---|
| PubChem CID | 139942691 |
| Molecular Formula | C25H26F3N5S |
| Molecular Weight | 485.58 g/mol |
| Exact Mass | 485.19 |
| IUPAC Name | 1-[2-[3-[(4-cyanophenyl)methyl]imidazol-4-yl]ethyl]-3-propyl-1-[[2-(trifluoromethyl)phenyl]methyl]thiourea |
| SMILES | CCCNC(=S)N(CCc1cncn1Cc1ccc(C#N)cc1)Cc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C25H26F3N5S/c1-2-12-31-24(34)32(17-21-5-3-4-6-23(21)25(26,27)28)13-11-22-15-30-18-33(22)16-20-9-7-19(14-29)8-10-20/h3-10,15,18H,2,11-13,16-17H2,1H3,(H,31,34) |
| InChIKey | GMYBLUDIVSRYFQ-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 56.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.58 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|