C30H35F3N6O2S — CID 154449861
1-[(2S)-1-amino-4-[3-[(4-cyanophenyl)methyl]imidazol-4-yl]-3-oxo-2-propan-2-ylbutyl]-3-(2-methoxyethyl)-1-[[2-(trifluoromethyl)phenyl]methyl]thiourea (PubChem CID 154449861) has the molecular formula C30H35F3N6O2S and a molecular weight of 600.71 g/mol. Its IUPAC name is 1-[(2S)-1-amino-4-[3-[(4-cyanophenyl)methyl]imidazol-4-yl]-3-oxo-2-propan-2-ylbutyl]-3-(2-methoxyethyl)-1-[[2-(trifluoromethyl)phenyl]methyl]thiourea.
| Compound Name | 1-[(2S)-1-amino-4-[3-[(4-cyanophenyl)methyl]imidazol-4-yl]-3-oxo-2-propan-2-ylbutyl]-3-(2-methoxyethyl)-1-[[2-(trifluoromethyl)phenyl]methyl]thiourea |
|---|---|
| PubChem CID | 154449861 |
| Molecular Formula | C30H35F3N6O2S |
| Molecular Weight | 600.71 g/mol |
| Exact Mass | 600.25 |
| IUPAC Name | 1-[(2S)-1-amino-4-[3-[(4-cyanophenyl)methyl]imidazol-4-yl]-3-oxo-2-propan-2-ylbutyl]-3-(2-methoxyethyl)-1-[[2-(trifluoromethyl)phenyl]methyl]thiourea |
| SMILES | COCCNC(=S)N(Cc1ccccc1C(F)(F)F)C(N)[C@@H](C(=O)Cc1cncn1Cc1ccc(C#N)cc1)C(C)C |
| InChI | InChI=1S/C30H35F3N6O2S/c1-20(2)27(26(40)14-24-16-36-19-38(24)17-22-10-8-21(15-34)9-11-22)28(35)39(29(42)37-12-13-41-3)18-23-6-4-5-7-25(23)30(31,32)33/h4-11,16,19-20,27-28H,12-14,17-18,35H2,1-3H3,(H,37,42)/t27-,28?/m1/s1 |
| InChIKey | QXQBYYPTBFVMDA-QXPUDEPPSA-N |
| XLogP | 4.51 |
| TPSA | 109.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.71 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|