C27H30F3N5OS — CID 139942622
1-[2-[3-[(4-cyanophenyl)methyl]imidazol-4-yl]ethyl]-3-(3-ethoxypropyl)-1-[[2-(trifluoromethyl)phenyl]methyl]thiourea (PubChem CID 139942622) has the molecular formula C27H30F3N5OS and a molecular weight of 529.63 g/mol. Its IUPAC name is 1-[2-[3-[(4-cyanophenyl)methyl]imidazol-4-yl]ethyl]-3-(3-ethoxypropyl)-1-[[2-(trifluoromethyl)phenyl]methyl]thiourea.
| Compound Name | 1-[2-[3-[(4-cyanophenyl)methyl]imidazol-4-yl]ethyl]-3-(3-ethoxypropyl)-1-[[2-(trifluoromethyl)phenyl]methyl]thiourea |
|---|---|
| PubChem CID | 139942622 |
| Molecular Formula | C27H30F3N5OS |
| Molecular Weight | 529.63 g/mol |
| Exact Mass | 529.21 |
| IUPAC Name | 1-[2-[3-[(4-cyanophenyl)methyl]imidazol-4-yl]ethyl]-3-(3-ethoxypropyl)-1-[[2-(trifluoromethyl)phenyl]methyl]thiourea |
| SMILES | CCOCCCNC(=S)N(CCc1cncn1Cc1ccc(C#N)cc1)Cc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C27H30F3N5OS/c1-2-36-15-5-13-33-26(37)34(19-23-6-3-4-7-25(23)27(28,29)30)14-12-24-17-32-20-35(24)18-22-10-8-21(16-31)9-11-22/h3-4,6-11,17,20H,2,5,12-15,18-19H2,1H3,(H,33,37) |
| InChIKey | PXSZDFBQOORQOH-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 66.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.63 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|