C24H23Cl2N5O2S — CID 139942676
ethyl N-[2-[3-[(4-cyanophenyl)methyl]imidazol-4-yl]ethyl-[(2,3-dichlorophenyl)methyl]carbamothioyl]carbamate (PubChem CID 139942676) has the molecular formula C24H23Cl2N5O2S and a molecular weight of 516.45 g/mol. Its IUPAC name is ethyl N-[2-[3-[(4-cyanophenyl)methyl]imidazol-4-yl]ethyl-[(2,3-dichlorophenyl)methyl]carbamothioyl]carbamate.
| Compound Name | ethyl N-[2-[3-[(4-cyanophenyl)methyl]imidazol-4-yl]ethyl-[(2,3-dichlorophenyl)methyl]carbamothioyl]carbamate |
|---|---|
| PubChem CID | 139942676 |
| Molecular Formula | C24H23Cl2N5O2S |
| Molecular Weight | 516.45 g/mol |
| Exact Mass | 515.09 |
| IUPAC Name | ethyl N-[2-[3-[(4-cyanophenyl)methyl]imidazol-4-yl]ethyl-[(2,3-dichlorophenyl)methyl]carbamothioyl]carbamate |
| SMILES | CCOC(=O)NC(=S)N(CCc1cncn1Cc1ccc(C#N)cc1)Cc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C24H23Cl2N5O2S/c1-2-33-24(32)29-23(34)30(15-19-4-3-5-21(25)22(19)26)11-10-20-13-28-16-31(20)14-18-8-6-17(12-27)7-9-18/h3-9,13,16H,2,10-11,14-15H2,1H3,(H,29,32,34) |
| InChIKey | IJRKIIZLEFHVHG-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 83.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.45 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|