C29H26Cl2N6O2S — CID 142631670
2-[3-[(4-cyanophenyl)methyl]imidazol-4-yl]-N-[2-[(2,3-dichlorophenyl)methyl-[(4-hydroxyphenyl)carbamothioyl]amino]ethyl]acetamide (PubChem CID 142631670) has the molecular formula C29H26Cl2N6O2S and a molecular weight of 593.54 g/mol. Its IUPAC name is 2-[3-[(4-cyanophenyl)methyl]imidazol-4-yl]-N-[2-[(2,3-dichlorophenyl)methyl-[(4-hydroxyphenyl)carbamothioyl]amino]ethyl]acetamide.
| Compound Name | 2-[3-[(4-cyanophenyl)methyl]imidazol-4-yl]-N-[2-[(2,3-dichlorophenyl)methyl-[(4-hydroxyphenyl)carbamothioyl]amino]ethyl]acetamide |
|---|---|
| PubChem CID | 142631670 |
| Molecular Formula | C29H26Cl2N6O2S |
| Molecular Weight | 593.54 g/mol |
| Exact Mass | 592.12 |
| IUPAC Name | 2-[3-[(4-cyanophenyl)methyl]imidazol-4-yl]-N-[2-[(2,3-dichlorophenyl)methyl-[(4-hydroxyphenyl)carbamothioyl]amino]ethyl]acetamide |
| SMILES | N#Cc1ccc(Cn2cncc2CC(=O)NCCN(Cc2cccc(Cl)c2Cl)C(=S)Nc2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C29H26Cl2N6O2S/c30-26-3-1-2-22(28(26)31)18-36(29(40)35-23-8-10-25(38)11-9-23)13-12-34-27(39)14-24-16-33-19-37(24)17-21-6-4-20(15-32)5-7-21/h1-11,16,19,38H,12-14,17-18H2,(H,34,39)(H,35,40) |
| InChIKey | PSSVRYALYUTKDG-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 106.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.54 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|