C29H27Cl2N5OS — CID 139942729
1-[3-[3-[(4-cyanophenyl)methyl]imidazol-4-yl]propyl]-1-[(2,3-dichlorophenyl)methyl]-3-(4-methoxyphenyl)thiourea (PubChem CID 139942729) has the molecular formula C29H27Cl2N5OS and a molecular weight of 564.54 g/mol. Its IUPAC name is 1-[3-[3-[(4-cyanophenyl)methyl]imidazol-4-yl]propyl]-1-[(2,3-dichlorophenyl)methyl]-3-(4-methoxyphenyl)thiourea.
| Compound Name | 1-[3-[3-[(4-cyanophenyl)methyl]imidazol-4-yl]propyl]-1-[(2,3-dichlorophenyl)methyl]-3-(4-methoxyphenyl)thiourea |
|---|---|
| PubChem CID | 139942729 |
| Molecular Formula | C29H27Cl2N5OS |
| Molecular Weight | 564.54 g/mol |
| Exact Mass | 563.13 |
| IUPAC Name | 1-[3-[3-[(4-cyanophenyl)methyl]imidazol-4-yl]propyl]-1-[(2,3-dichlorophenyl)methyl]-3-(4-methoxyphenyl)thiourea |
| SMILES | COc1ccc(NC(=S)N(CCCc2cncn2Cc2ccc(C#N)cc2)Cc2cccc(Cl)c2Cl)cc1 |
| InChI | InChI=1S/C29H27Cl2N5OS/c1-37-26-13-11-24(12-14-26)34-29(38)35(19-23-4-2-6-27(30)28(23)31)15-3-5-25-17-33-20-36(25)18-22-9-7-21(16-32)8-10-22/h2,4,6-14,17,20H,3,5,15,18-19H2,1H3,(H,34,38) |
| InChIKey | BAYFUFJFMDBYEZ-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 66.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.54 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|