C30H28N6OS — CID 139942688
1-[2-[3-[(4-cyanophenyl)methyl]imidazol-4-yl]ethyl]-1-(1H-indol-3-ylmethyl)-3-(4-methoxyphenyl)thiourea (PubChem CID 139942688) has the molecular formula C30H28N6OS and a molecular weight of 520.66 g/mol. Its IUPAC name is 1-[2-[3-[(4-cyanophenyl)methyl]imidazol-4-yl]ethyl]-1-(1H-indol-3-ylmethyl)-3-(4-methoxyphenyl)thiourea.
| Compound Name | 1-[2-[3-[(4-cyanophenyl)methyl]imidazol-4-yl]ethyl]-1-(1H-indol-3-ylmethyl)-3-(4-methoxyphenyl)thiourea |
|---|---|
| PubChem CID | 139942688 |
| Molecular Formula | C30H28N6OS |
| Molecular Weight | 520.66 g/mol |
| Exact Mass | 520.20 |
| IUPAC Name | 1-[2-[3-[(4-cyanophenyl)methyl]imidazol-4-yl]ethyl]-1-(1H-indol-3-ylmethyl)-3-(4-methoxyphenyl)thiourea |
| SMILES | COc1ccc(NC(=S)N(CCc2cncn2Cc2ccc(C#N)cc2)Cc2c[nH]c3ccccc23)cc1 |
| InChI | InChI=1S/C30H28N6OS/c1-37-27-12-10-25(11-13-27)34-30(38)35(20-24-17-33-29-5-3-2-4-28(24)29)15-14-26-18-32-21-36(26)19-23-8-6-22(16-31)7-9-23/h2-13,17-18,21,33H,14-15,19-20H2,1H3,(H,34,38) |
| InChIKey | SGKFXFCAQDUMMA-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 81.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.66 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|