C28H27N5S — CID 139942617
1-[2-[3-[(4-cyanophenyl)methyl]imidazol-4-yl]ethyl]-1-(2-methylphenyl)-3-(4-methylphenyl)thiourea (PubChem CID 139942617) has the molecular formula C28H27N5S and a molecular weight of 465.63 g/mol. Its IUPAC name is 1-[2-[3-[(4-cyanophenyl)methyl]imidazol-4-yl]ethyl]-1-(2-methylphenyl)-3-(4-methylphenyl)thiourea.
| Compound Name | 1-[2-[3-[(4-cyanophenyl)methyl]imidazol-4-yl]ethyl]-1-(2-methylphenyl)-3-(4-methylphenyl)thiourea |
|---|---|
| PubChem CID | 139942617 |
| Molecular Formula | C28H27N5S |
| Molecular Weight | 465.63 g/mol |
| Exact Mass | 465.20 |
| IUPAC Name | 1-[2-[3-[(4-cyanophenyl)methyl]imidazol-4-yl]ethyl]-1-(2-methylphenyl)-3-(4-methylphenyl)thiourea |
| SMILES | Cc1ccc(NC(=S)N(CCc2cncn2Cc2ccc(C#N)cc2)c2ccccc2C)cc1 |
| InChI | InChI=1S/C28H27N5S/c1-21-7-13-25(14-8-21)31-28(34)33(27-6-4-3-5-22(27)2)16-15-26-18-30-20-32(26)19-24-11-9-23(17-29)10-12-24/h3-14,18,20H,15-16,19H2,1-2H3,(H,31,34) |
| InChIKey | WMMVFKWQRLGPHM-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 56.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.63 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|