C31H30N6O2S — CID 139942578
1-[2-[3-[(4-cyanophenyl)methyl]imidazol-4-yl]ethyl]-1-[(5-methoxy-1H-indol-3-yl)methyl]-3-(4-methoxyphenyl)thiourea (PubChem CID 139942578) has the molecular formula C31H30N6O2S and a molecular weight of 550.69 g/mol. Its IUPAC name is 1-[2-[3-[(4-cyanophenyl)methyl]imidazol-4-yl]ethyl]-1-[(5-methoxy-1H-indol-3-yl)methyl]-3-(4-methoxyphenyl)thiourea.
| Compound Name | 1-[2-[3-[(4-cyanophenyl)methyl]imidazol-4-yl]ethyl]-1-[(5-methoxy-1H-indol-3-yl)methyl]-3-(4-methoxyphenyl)thiourea |
|---|---|
| PubChem CID | 139942578 |
| Molecular Formula | C31H30N6O2S |
| Molecular Weight | 550.69 g/mol |
| Exact Mass | 550.22 |
| IUPAC Name | 1-[2-[3-[(4-cyanophenyl)methyl]imidazol-4-yl]ethyl]-1-[(5-methoxy-1H-indol-3-yl)methyl]-3-(4-methoxyphenyl)thiourea |
| SMILES | COc1ccc(NC(=S)N(CCc2cncn2Cc2ccc(C#N)cc2)Cc2c[nH]c3ccc(OC)cc23)cc1 |
| InChI | InChI=1S/C31H30N6O2S/c1-38-27-9-7-25(8-10-27)35-31(40)36(20-24-17-34-30-12-11-28(39-2)15-29(24)30)14-13-26-18-33-21-37(26)19-23-5-3-22(16-32)4-6-23/h3-12,15,17-18,21,34H,13-14,19-20H2,1-2H3,(H,35,40) |
| InChIKey | RZDIELIBLPPWQG-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 91.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.69 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|