C34H37N7O4S — CID 142631617
2-[3-[(4-cyanophenyl)methyl]imidazol-4-yl]-N-[(2S,3S)-1-[(4-methoxyphenyl)carbamothioyl-[(4-nitrophenyl)methyl]amino]-3-methylpentan-2-yl]acetamide (PubChem CID 142631617) has the molecular formula C34H37N7O4S and a molecular weight of 639.78 g/mol. Its IUPAC name is 2-[3-[(4-cyanophenyl)methyl]imidazol-4-yl]-N-[(2S,3S)-1-[(4-methoxyphenyl)carbamothioyl-[(4-nitrophenyl)methyl]amino]-3-methylpentan-2-yl]acetamide.
| Compound Name | 2-[3-[(4-cyanophenyl)methyl]imidazol-4-yl]-N-[(2S,3S)-1-[(4-methoxyphenyl)carbamothioyl-[(4-nitrophenyl)methyl]amino]-3-methylpentan-2-yl]acetamide |
|---|---|
| PubChem CID | 142631617 |
| Molecular Formula | C34H37N7O4S |
| Molecular Weight | 639.78 g/mol |
| Exact Mass | 639.26 |
| IUPAC Name | 2-[3-[(4-cyanophenyl)methyl]imidazol-4-yl]-N-[(2S,3S)-1-[(4-methoxyphenyl)carbamothioyl-[(4-nitrophenyl)methyl]amino]-3-methylpentan-2-yl]acetamide |
| SMILES | CC[C@H](C)[C@@H](CN(Cc1ccc([N+](=O)[O-])cc1)C(=S)Nc1ccc(OC)cc1)NC(=O)Cc1cncn1Cc1ccc(C#N)cc1 |
| InChI | InChI=1S/C34H37N7O4S/c1-4-24(2)32(38-33(42)17-30-19-36-23-40(30)21-26-7-5-25(18-35)6-8-26)22-39(20-27-9-13-29(14-10-27)41(43)44)34(46)37-28-11-15-31(45-3)16-12-28/h5-16,19,23-24,32H,4,17,20-22H2,1-3H3,(H,37,46)(H,38,42)/t24-,32+/m0/s1 |
| InChIKey | VQECSRKSDLQQFJ-NRUKRWIHSA-N |
| XLogP | 5.69 |
| TPSA | 138.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.78 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|