C37H39N5O4 — CID 142634425
4-methyl-N-[(2S,3S)-3-methyl-2-[[2-[3-[(4-nitrophenyl)methyl]imidazol-4-yl]acetyl]amino]pentyl]-N-(naphthalen-1-ylmethyl)benzamide (PubChem CID 142634425) has the molecular formula C37H39N5O4 and a molecular weight of 617.75 g/mol. Its IUPAC name is 4-methyl-N-[(2S,3S)-3-methyl-2-[[2-[3-[(4-nitrophenyl)methyl]imidazol-4-yl]acetyl]amino]pentyl]-N-(naphthalen-1-ylmethyl)benzamide.
| Compound Name | 4-methyl-N-[(2S,3S)-3-methyl-2-[[2-[3-[(4-nitrophenyl)methyl]imidazol-4-yl]acetyl]amino]pentyl]-N-(naphthalen-1-ylmethyl)benzamide |
|---|---|
| PubChem CID | 142634425 |
| Molecular Formula | C37H39N5O4 |
| Molecular Weight | 617.75 g/mol |
| Exact Mass | 617.30 |
| IUPAC Name | 4-methyl-N-[(2S,3S)-3-methyl-2-[[2-[3-[(4-nitrophenyl)methyl]imidazol-4-yl]acetyl]amino]pentyl]-N-(naphthalen-1-ylmethyl)benzamide |
| SMILES | CC[C@H](C)[C@@H](CN(Cc1cccc2ccccc12)C(=O)c1ccc(C)cc1)NC(=O)Cc1cncn1Cc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C37H39N5O4/c1-4-27(3)35(39-36(43)20-33-21-38-25-41(33)22-28-14-18-32(19-15-28)42(45)46)24-40(37(44)30-16-12-26(2)13-17-30)23-31-10-7-9-29-8-5-6-11-34(29)31/h5-19,21,25,27,35H,4,20,22-24H2,1-3H3,(H,39,43)/t27-,35+/m0/s1 |
| InChIKey | UPWRITQWBQOYAE-JCVFDAPQSA-N |
| XLogP | 6.72 |
| TPSA | 110.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.75 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|