C40H45N5O4 — CID 142634477
4-butyl-N-[(2S,3S)-3-methyl-2-[[2-[3-[(4-nitrophenyl)methyl]imidazol-4-yl]acetyl]amino]pentyl]-N-(naphthalen-1-ylmethyl)benzamide (PubChem CID 142634477) has the molecular formula C40H45N5O4 and a molecular weight of 659.83 g/mol. Its IUPAC name is 4-butyl-N-[(2S,3S)-3-methyl-2-[[2-[3-[(4-nitrophenyl)methyl]imidazol-4-yl]acetyl]amino]pentyl]-N-(naphthalen-1-ylmethyl)benzamide.
| Compound Name | 4-butyl-N-[(2S,3S)-3-methyl-2-[[2-[3-[(4-nitrophenyl)methyl]imidazol-4-yl]acetyl]amino]pentyl]-N-(naphthalen-1-ylmethyl)benzamide |
|---|---|
| PubChem CID | 142634477 |
| Molecular Formula | C40H45N5O4 |
| Molecular Weight | 659.83 g/mol |
| Exact Mass | 659.35 |
| IUPAC Name | 4-butyl-N-[(2S,3S)-3-methyl-2-[[2-[3-[(4-nitrophenyl)methyl]imidazol-4-yl]acetyl]amino]pentyl]-N-(naphthalen-1-ylmethyl)benzamide |
| SMILES | CCCCc1ccc(C(=O)N(Cc2cccc3ccccc23)C[C@@H](NC(=O)Cc2cncn2Cc2ccc([N+](=O)[O-])cc2)[C@@H](C)CC)cc1 |
| InChI | InChI=1S/C40H45N5O4/c1-4-6-10-30-15-19-33(20-16-30)40(47)43(26-34-13-9-12-32-11-7-8-14-37(32)34)27-38(29(3)5-2)42-39(46)23-36-24-41-28-44(36)25-31-17-21-35(22-18-31)45(48)49/h7-9,11-22,24,28-29,38H,4-6,10,23,25-27H2,1-3H3,(H,42,46)/t29-,38+/m0/s1 |
| InChIKey | USHHJUAPCVNNLH-SXSCYYOBSA-N |
| XLogP | 7.75 |
| TPSA | 110.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.83 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|