C37H40N6O3S — CID 142631633
N-[(2S,3S)-1-[benzylcarbamothioyl(naphthalen-1-ylmethyl)amino]-3-methylpentan-2-yl]-2-[3-[(4-nitrophenyl)methyl]imidazol-4-yl]acetamide (PubChem CID 142631633) has the molecular formula C37H40N6O3S and a molecular weight of 648.83 g/mol. Its IUPAC name is N-[(2S,3S)-1-[benzylcarbamothioyl(naphthalen-1-ylmethyl)amino]-3-methylpentan-2-yl]-2-[3-[(4-nitrophenyl)methyl]imidazol-4-yl]acetamide.
| Compound Name | N-[(2S,3S)-1-[benzylcarbamothioyl(naphthalen-1-ylmethyl)amino]-3-methylpentan-2-yl]-2-[3-[(4-nitrophenyl)methyl]imidazol-4-yl]acetamide |
|---|---|
| PubChem CID | 142631633 |
| Molecular Formula | C37H40N6O3S |
| Molecular Weight | 648.83 g/mol |
| Exact Mass | 648.29 |
| IUPAC Name | N-[(2S,3S)-1-[benzylcarbamothioyl(naphthalen-1-ylmethyl)amino]-3-methylpentan-2-yl]-2-[3-[(4-nitrophenyl)methyl]imidazol-4-yl]acetamide |
| SMILES | CC[C@H](C)[C@@H](CN(Cc1cccc2ccccc12)C(=S)NCc1ccccc1)NC(=O)Cc1cncn1Cc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C37H40N6O3S/c1-3-27(2)35(40-36(44)20-33-22-38-26-42(33)23-29-16-18-32(19-17-29)43(45)46)25-41(37(47)39-21-28-10-5-4-6-11-28)24-31-14-9-13-30-12-7-8-15-34(30)31/h4-19,22,26-27,35H,3,20-21,23-25H2,1-2H3,(H,39,47)(H,40,44)/t27-,35+/m0/s1 |
| InChIKey | XGWIDHVMIYWOMI-JCVFDAPQSA-N |
| XLogP | 6.64 |
| TPSA | 105.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.83 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|