C31H38Cl2N6OS — CID 142631861
N-[(2S,3S)-1-[butylcarbamothioyl-[(2,3-dichlorophenyl)methyl]amino]-3-methylpentan-2-yl]-2-[3-[(4-cyanophenyl)methyl]imidazol-4-yl]acetamide (PubChem CID 142631861) has the molecular formula C31H38Cl2N6OS and a molecular weight of 613.66 g/mol. Its IUPAC name is N-[(2S,3S)-1-[butylcarbamothioyl-[(2,3-dichlorophenyl)methyl]amino]-3-methylpentan-2-yl]-2-[3-[(4-cyanophenyl)methyl]imidazol-4-yl]acetamide.
| Compound Name | N-[(2S,3S)-1-[butylcarbamothioyl-[(2,3-dichlorophenyl)methyl]amino]-3-methylpentan-2-yl]-2-[3-[(4-cyanophenyl)methyl]imidazol-4-yl]acetamide |
|---|---|
| PubChem CID | 142631861 |
| Molecular Formula | C31H38Cl2N6OS |
| Molecular Weight | 613.66 g/mol |
| Exact Mass | 612.22 |
| IUPAC Name | N-[(2S,3S)-1-[butylcarbamothioyl-[(2,3-dichlorophenyl)methyl]amino]-3-methylpentan-2-yl]-2-[3-[(4-cyanophenyl)methyl]imidazol-4-yl]acetamide |
| SMILES | CCCCNC(=S)N(Cc1cccc(Cl)c1Cl)C[C@@H](NC(=O)Cc1cncn1Cc1ccc(C#N)cc1)[C@@H](C)CC |
| InChI | InChI=1S/C31H38Cl2N6OS/c1-4-6-14-36-31(41)38(19-25-8-7-9-27(32)30(25)33)20-28(22(3)5-2)37-29(40)15-26-17-35-21-39(26)18-24-12-10-23(16-34)11-13-24/h7-13,17,21-22,28H,4-6,14-15,18-20H2,1-3H3,(H,36,41)(H,37,40)/t22-,28+/m0/s1 |
| InChIKey | OCYPGDXXWARGMD-RBISFHTESA-N |
| XLogP | 6.36 |
| TPSA | 85.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.66 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|