C33H34Cl2N6O2S — CID 142631885
2-[3-[(4-cyanophenyl)methyl]imidazol-4-yl]-N-[(2S)-1-[(2,3-dichlorophenyl)methyl-[(4-hydroxyphenyl)carbamothioyl]amino]-4-methylpentan-2-yl]acetamide (PubChem CID 142631885) has the molecular formula C33H34Cl2N6O2S and a molecular weight of 649.65 g/mol. Its IUPAC name is 2-[3-[(4-cyanophenyl)methyl]imidazol-4-yl]-N-[(2S)-1-[(2,3-dichlorophenyl)methyl-[(4-hydroxyphenyl)carbamothioyl]amino]-4-methylpentan-2-yl]acetamide.
| Compound Name | 2-[3-[(4-cyanophenyl)methyl]imidazol-4-yl]-N-[(2S)-1-[(2,3-dichlorophenyl)methyl-[(4-hydroxyphenyl)carbamothioyl]amino]-4-methylpentan-2-yl]acetamide |
|---|---|
| PubChem CID | 142631885 |
| Molecular Formula | C33H34Cl2N6O2S |
| Molecular Weight | 649.65 g/mol |
| Exact Mass | 648.18 |
| IUPAC Name | 2-[3-[(4-cyanophenyl)methyl]imidazol-4-yl]-N-[(2S)-1-[(2,3-dichlorophenyl)methyl-[(4-hydroxyphenyl)carbamothioyl]amino]-4-methylpentan-2-yl]acetamide |
| SMILES | CC(C)C[C@@H](CN(Cc1cccc(Cl)c1Cl)C(=S)Nc1ccc(O)cc1)NC(=O)Cc1cncn1Cc1ccc(C#N)cc1 |
| InChI | InChI=1S/C33H34Cl2N6O2S/c1-22(2)14-27(38-31(43)15-28-17-37-21-41(28)18-24-8-6-23(16-36)7-9-24)20-40(19-25-4-3-5-30(34)32(25)35)33(44)39-26-10-12-29(42)13-11-26/h3-13,17,21-22,27,42H,14-15,18-20H2,1-2H3,(H,38,43)(H,39,44)/t27-/m0/s1 |
| InChIKey | ANUQJXTULFCMFV-MHZLTWQESA-N |
| XLogP | 6.79 |
| TPSA | 106.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.65 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|