C31H30Cl2N6O2S — CID 142631736
2-[3-[(4-cyanophenyl)methyl]imidazol-4-yl]-N-[1-[(2,3-dichlorophenyl)methyl-[(4-hydroxyphenyl)carbamothioyl]amino]-2-methylpropan-2-yl]acetamide (PubChem CID 142631736) has the molecular formula C31H30Cl2N6O2S and a molecular weight of 621.59 g/mol. Its IUPAC name is 2-[3-[(4-cyanophenyl)methyl]imidazol-4-yl]-N-[1-[(2,3-dichlorophenyl)methyl-[(4-hydroxyphenyl)carbamothioyl]amino]-2-methylpropan-2-yl]acetamide.
| Compound Name | 2-[3-[(4-cyanophenyl)methyl]imidazol-4-yl]-N-[1-[(2,3-dichlorophenyl)methyl-[(4-hydroxyphenyl)carbamothioyl]amino]-2-methylpropan-2-yl]acetamide |
|---|---|
| PubChem CID | 142631736 |
| Molecular Formula | C31H30Cl2N6O2S |
| Molecular Weight | 621.59 g/mol |
| Exact Mass | 620.15 |
| IUPAC Name | 2-[3-[(4-cyanophenyl)methyl]imidazol-4-yl]-N-[1-[(2,3-dichlorophenyl)methyl-[(4-hydroxyphenyl)carbamothioyl]amino]-2-methylpropan-2-yl]acetamide |
| SMILES | CC(C)(CN(Cc1cccc(Cl)c1Cl)C(=S)Nc1ccc(O)cc1)NC(=O)Cc1cncn1Cc1ccc(C#N)cc1 |
| InChI | InChI=1S/C31H30Cl2N6O2S/c1-31(2,37-28(41)14-25-16-35-20-39(25)17-22-8-6-21(15-34)7-9-22)19-38(18-23-4-3-5-27(32)29(23)33)30(42)36-24-10-12-26(40)13-11-24/h3-13,16,20,40H,14,17-19H2,1-2H3,(H,36,42)(H,37,41) |
| InChIKey | GWZBOLWXZPPNNX-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 106.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.59 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|