C29H33N3O4S — CID 17340919
1-[(3,4-dimethoxyphenyl)methyl]-3-(4-ethoxyphenyl)-1-[2-(5-methoxy-1H-indol-3-yl)ethyl]thiourea (PubChem CID 17340919) has the molecular formula C29H33N3O4S and a molecular weight of 519.67 g/mol. Its IUPAC name is 1-[(3,4-dimethoxyphenyl)methyl]-3-(4-ethoxyphenyl)-1-[2-(5-methoxy-1H-indol-3-yl)ethyl]thiourea.
| Compound Name | 1-[(3,4-dimethoxyphenyl)methyl]-3-(4-ethoxyphenyl)-1-[2-(5-methoxy-1H-indol-3-yl)ethyl]thiourea |
|---|---|
| PubChem CID | 17340919 |
| Molecular Formula | C29H33N3O4S |
| Molecular Weight | 519.67 g/mol |
| Exact Mass | 519.22 |
| IUPAC Name | 1-[(3,4-dimethoxyphenyl)methyl]-3-(4-ethoxyphenyl)-1-[2-(5-methoxy-1H-indol-3-yl)ethyl]thiourea |
| SMILES | CCOc1ccc(NC(=S)N(CCc2c[nH]c3ccc(OC)cc23)Cc2ccc(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C29H33N3O4S/c1-5-36-23-9-7-22(8-10-23)31-29(37)32(19-20-6-13-27(34-3)28(16-20)35-4)15-14-21-18-30-26-12-11-24(33-2)17-25(21)26/h6-13,16-18,30H,5,14-15,19H2,1-4H3,(H,31,37) |
| InChIKey | OTSDYHISDAVRNS-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 67.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.67 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|