C30H33N3O5S — CID 17340945
methyl 2-[4-[[(3-ethoxy-4-hydroxyphenyl)methyl-[2-(5-methoxy-1H-indol-3-yl)ethyl]carbamothioyl]amino]phenyl]acetate (PubChem CID 17340945) has the molecular formula C30H33N3O5S and a molecular weight of 547.68 g/mol. Its IUPAC name is methyl 2-[4-[[(3-ethoxy-4-hydroxyphenyl)methyl-[2-(5-methoxy-1H-indol-3-yl)ethyl]carbamothioyl]amino]phenyl]acetate.
| Compound Name | methyl 2-[4-[[(3-ethoxy-4-hydroxyphenyl)methyl-[2-(5-methoxy-1H-indol-3-yl)ethyl]carbamothioyl]amino]phenyl]acetate |
|---|---|
| PubChem CID | 17340945 |
| Molecular Formula | C30H33N3O5S |
| Molecular Weight | 547.68 g/mol |
| Exact Mass | 547.21 |
| IUPAC Name | methyl 2-[4-[[(3-ethoxy-4-hydroxyphenyl)methyl-[2-(5-methoxy-1H-indol-3-yl)ethyl]carbamothioyl]amino]phenyl]acetate |
| SMILES | CCOc1cc(CN(CCc2c[nH]c3ccc(OC)cc23)C(=S)Nc2ccc(CC(=O)OC)cc2)ccc1O |
| InChI | InChI=1S/C30H33N3O5S/c1-4-38-28-15-21(7-12-27(28)34)19-33(14-13-22-18-31-26-11-10-24(36-2)17-25(22)26)30(39)32-23-8-5-20(6-9-23)16-29(35)37-3/h5-12,15,17-18,31,34H,4,13-14,16,19H2,1-3H3,(H,32,39) |
| InChIKey | NRJWOYQQBAVJPM-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 96.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.68 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|