C29H29N3O6 — CID 166630821
N-hydroxy-4-[[[(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]-[2-(5-methoxy-1H-indol-3-yl)ethyl]amino]methyl]benzamide (PubChem CID 166630821) has the molecular formula C29H29N3O6 and a molecular weight of 515.57 g/mol. Its IUPAC name is N-hydroxy-4-[[[(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]-[2-(5-methoxy-1H-indol-3-yl)ethyl]amino]methyl]benzamide.
| Compound Name | N-hydroxy-4-[[[(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]-[2-(5-methoxy-1H-indol-3-yl)ethyl]amino]methyl]benzamide |
|---|---|
| PubChem CID | 166630821 |
| Molecular Formula | C29H29N3O6 |
| Molecular Weight | 515.57 g/mol |
| Exact Mass | 515.21 |
| IUPAC Name | N-hydroxy-4-[[[(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]-[2-(5-methoxy-1H-indol-3-yl)ethyl]amino]methyl]benzamide |
| SMILES | COc1ccc2[nH]cc(CCN(Cc3ccc(C(=O)NO)cc3)C(=O)/C=C/c3ccc(O)c(OC)c3)c2c1 |
| InChI | InChI=1S/C29H29N3O6/c1-37-23-9-10-25-24(16-23)22(17-30-25)13-14-32(18-20-3-7-21(8-4-20)29(35)31-36)28(34)12-6-19-5-11-26(33)27(15-19)38-2/h3-12,15-17,30,33,36H,13-14,18H2,1-2H3,(H,31,35)/b12-6+ |
| InChIKey | BOSHROJUQKKPJB-WUXMJOGZSA-N |
| XLogP | 4.29 |
| TPSA | 124.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.57 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|